C22H28O6 — CID 89263299
1-O-[(3-hydroxycyclohexyl)methyl] 4-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) benzene-1,4-dicarboxylate (PubChem CID 89263299) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-O-[(3-hydroxycyclohexyl)methyl] 4-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[(3-hydroxycyclohexyl)methyl] 4-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89263299 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-O-[(3-hydroxycyclohexyl)methyl] 4-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) benzene-1,4-dicarboxylate |
| SMILES | O=C(OCC1CCCC(O)C1)c1ccc(C(=O)OCC2CCC3OC3C2)cc1 |
| InChI | InChI=1S/C22H28O6/c23-18-3-1-2-14(10-18)12-26-21(24)16-5-7-17(8-6-16)22(25)27-13-15-4-9-19-20(11-15)28-19/h5-8,14-15,18-20,23H,1-4,9-13H2 |
| InChIKey | YYSYXCZSFUOMLB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|