C18H26O2 — CID 18346400
(2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18346400) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18346400 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (2,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C)C2CCC(C2)C1(C)OC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C18H26O2/c1-17(2)13-6-7-14(10-13)18(17,3)20-16(19)15-9-11-4-5-12(15)8-11/h4-5,11-15H,6-10H2,1-3H3 |
| InChIKey | KHWMOBDCLPEKNS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|