C12H25N — CID 18346668
1,3-ditert-butylpyrrolidine (PubChem CID 18346668) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 1,3-ditert-butylpyrrolidine.
| Compound Name | 1,3-ditert-butylpyrrolidine |
|---|---|
| PubChem CID | 18346668 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 1,3-ditert-butylpyrrolidine |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25N/c1-11(2,3)10-7-8-13(9-10)12(4,5)6/h10H,7-9H2,1-6H3 |
| InChIKey | ZHGZNKAHWWUSSU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |