C16H32O6Si2 — CID 18347792
trimethoxy-[(4-prop-1-en-2-ylcyclohexen-1-yl)-trimethoxysilylmethyl]silane (PubChem CID 18347792) has the molecular formula C16H32O6Si2 and a molecular weight of 376.60 g/mol. Its IUPAC name is trimethoxy-[(4-prop-1-en-2-ylcyclohexen-1-yl)-trimethoxysilylmethyl]silane.
| Compound Name | trimethoxy-[(4-prop-1-en-2-ylcyclohexen-1-yl)-trimethoxysilylmethyl]silane |
|---|---|
| PubChem CID | 18347792 |
| Molecular Formula | C16H32O6Si2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | trimethoxy-[(4-prop-1-en-2-ylcyclohexen-1-yl)-trimethoxysilylmethyl]silane |
| SMILES | C=C(C)C1CC=C(C([Si](OC)(OC)OC)[Si](OC)(OC)OC)CC1 |
| InChI | InChI=1S/C16H32O6Si2/c1-13(2)14-9-11-15(12-10-14)16(23(17-3,18-4)19-5)24(20-6,21-7)22-8/h11,14,16H,1,9-10,12H2,2-8H3 |
| InChIKey | XMNVXMFHPDZDNQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|