C23H22ClN3O4 — CID 18349022
2-[3-chloro-5-[ethyl(phenyl)carbamoyl]phenoxy]ethyl-pyridin-4-ylcarbamic acid (PubChem CID 18349022) has the molecular formula C23H22ClN3O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is 2-[3-chloro-5-[ethyl(phenyl)carbamoyl]phenoxy]ethyl-pyridin-4-ylcarbamic acid.
| Compound Name | 2-[3-chloro-5-[ethyl(phenyl)carbamoyl]phenoxy]ethyl-pyridin-4-ylcarbamic acid |
|---|---|
| PubChem CID | 18349022 |
| Molecular Formula | C23H22ClN3O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-[3-chloro-5-[ethyl(phenyl)carbamoyl]phenoxy]ethyl-pyridin-4-ylcarbamic acid |
| SMILES | CCN(C(=O)c1cc(Cl)cc(OCCN(C(=O)O)c2ccncc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClN3O4/c1-2-26(19-6-4-3-5-7-19)22(28)17-14-18(24)16-21(15-17)31-13-12-27(23(29)30)20-8-10-25-11-9-20/h3-11,14-16H,2,12-13H2,1H3,(H,29,30) |
| InChIKey | JXHDGRJVDFVEON-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |