C28H32ClF3N4O6S — CID 18349125
N-[2-(tert-butylsulfamoyl)ethyl]-3-chloro-N-phenyl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 18349125) has the molecular formula C28H32ClF3N4O6S and a molecular weight of 645.10 g/mol. Its IUPAC name is N-[2-(tert-butylsulfamoyl)ethyl]-3-chloro-N-phenyl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(tert-butylsulfamoyl)ethyl]-3-chloro-N-phenyl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18349125 |
| Molecular Formula | C28H32ClF3N4O6S |
| Molecular Weight | 645.10 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | N-[2-(tert-butylsulfamoyl)ethyl]-3-chloro-N-phenyl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)NS(=O)(=O)CCN(C(=O)c1cc(Cl)cc(OCCNc2ccncc2)c1)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H31ClN4O4S.C2HF3O2/c1-26(2,3)30-36(33,34)16-14-31(23-7-5-4-6-8-23)25(32)20-17-21(27)19-24(18-20)35-15-13-29-22-9-11-28-12-10-22;3-2(4,5)1(6)7/h4-12,17-19,30H,13-16H2,1-3H3,(H,28,29);(H,6,7) |
| InChIKey | JMDRTNJIAHWJLA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.10 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|