C23H28ClF3N4O4S — CID 18349067
3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[3-(trifluoromethylsulfonylamino)propyl]benzamide (PubChem CID 18349067) has the molecular formula C23H28ClF3N4O4S and a molecular weight of 549.02 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[3-(trifluoromethylsulfonylamino)propyl]benzamide.
| Compound Name | 3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[3-(trifluoromethylsulfonylamino)propyl]benzamide |
|---|---|
| PubChem CID | 18349067 |
| Molecular Formula | C23H28ClF3N4O4S |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[3-(trifluoromethylsulfonylamino)propyl]benzamide |
| SMILES | O=C(c1cc(Cl)cc(OCCNc2ccncc2)c1)N(CCCNS(=O)(=O)C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C23H28ClF3N4O4S/c24-18-14-17(15-21(16-18)35-13-11-29-19-6-9-28-10-7-19)22(32)31(20-4-1-2-5-20)12-3-8-30-36(33,34)23(25,26)27/h6-7,9-10,14-16,20,30H,1-5,8,11-13H2,(H,28,29) |
| InChIKey | WAGXPBRUNISKLQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|