C24H29ClF3N3O6 — CID 18349034
3-chloro-N-cyclopentyl-N-(2,3-dihydroxypropyl)-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 18349034) has the molecular formula C24H29ClF3N3O6 and a molecular weight of 547.96 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-N-(2,3-dihydroxypropyl)-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-chloro-N-cyclopentyl-N-(2,3-dihydroxypropyl)-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18349034 |
| Molecular Formula | C24H29ClF3N3O6 |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-chloro-N-cyclopentyl-N-(2,3-dihydroxypropyl)-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cc(Cl)cc(OCCNc2ccncc2)c1)N(CC(O)CO)C1CCCC1 |
| InChI | InChI=1S/C22H28ClN3O4.C2HF3O2/c23-17-11-16(22(29)26(14-20(28)15-27)19-3-1-2-4-19)12-21(13-17)30-10-9-25-18-5-7-24-8-6-18;3-2(4,5)1(6)7/h5-8,11-13,19-20,27-28H,1-4,9-10,14-15H2,(H,24,25);(H,6,7) |
| InChIKey | MIYJUFYCYHHBLG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|