C26H34ClF3N4O5 — CID 18348863
N-(3-amino-3-oxopropyl)-3-chloro-N-heptan-4-yl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 18348863) has the molecular formula C26H34ClF3N4O5 and a molecular weight of 575.03 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-3-chloro-N-heptan-4-yl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-amino-3-oxopropyl)-3-chloro-N-heptan-4-yl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18348863 |
| Molecular Formula | C26H34ClF3N4O5 |
| Molecular Weight | 575.03 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-3-chloro-N-heptan-4-yl-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC(CCC)N(CCC(N)=O)C(=O)c1cc(Cl)cc(OCCNc2ccncc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H33ClN4O3.C2HF3O2/c1-3-5-21(6-4-2)29(13-9-23(26)30)24(31)18-15-19(25)17-22(16-18)32-14-12-28-20-7-10-27-11-8-20;3-2(4,5)1(6)7/h7-8,10-11,15-17,21H,3-6,9,12-14H2,1-2H3,(H2,26,30)(H,27,28);(H,6,7) |
| InChIKey | QRVWBHKTIVGULD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.03 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|