C29H31ClF4N4O5 — CID 18349160
N-(6-amino-6-oxohexyl)-3-chloro-N-[(2-fluorophenyl)methyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 18349160) has the molecular formula C29H31ClF4N4O5 and a molecular weight of 627.04 g/mol. Its IUPAC name is N-(6-amino-6-oxohexyl)-3-chloro-N-[(2-fluorophenyl)methyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(6-amino-6-oxohexyl)-3-chloro-N-[(2-fluorophenyl)methyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18349160 |
| Molecular Formula | C29H31ClF4N4O5 |
| Molecular Weight | 627.04 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | N-(6-amino-6-oxohexyl)-3-chloro-N-[(2-fluorophenyl)methyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)CCCCCN(Cc1ccccc1F)C(=O)c1cc(Cl)cc(OCCNc2ccncc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H30ClFN4O3.C2HF3O2/c28-22-16-21(17-24(18-22)36-15-13-32-23-9-11-31-12-10-23)27(35)33(14-5-1-2-8-26(30)34)19-20-6-3-4-7-25(20)29;3-2(4,5)1(6)7/h3-4,6-7,9-12,16-18H,1-2,5,8,13-15,19H2,(H2,30,34)(H,31,32);(H,6,7) |
| InChIKey | VGWLAFSCLHBQNN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|