C23H33ClN4O4S — CID 18349030
3-chloro-N-propan-2-yl-N-[3-(propylsulfonylamino)propyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide (PubChem CID 18349030) has the molecular formula C23H33ClN4O4S and a molecular weight of 497.06 g/mol. Its IUPAC name is 3-chloro-N-propan-2-yl-N-[3-(propylsulfonylamino)propyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide.
| Compound Name | 3-chloro-N-propan-2-yl-N-[3-(propylsulfonylamino)propyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 18349030 |
| Molecular Formula | C23H33ClN4O4S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-chloro-N-propan-2-yl-N-[3-(propylsulfonylamino)propyl]-5-[2-(pyridin-4-ylamino)ethoxy]benzamide |
| SMILES | CCCS(=O)(=O)NCCCN(C(=O)c1cc(Cl)cc(OCCNc2ccncc2)c1)C(C)C |
| InChI | InChI=1S/C23H33ClN4O4S/c1-4-14-33(30,31)27-8-5-12-28(18(2)3)23(29)19-15-20(24)17-22(16-19)32-13-11-26-21-6-9-25-10-7-21/h6-7,9-10,15-18,27H,4-5,8,11-14H2,1-3H3,(H,25,26) |
| InChIKey | KTPUVWWARPPYPY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|