C21H36N2O3S — CID 18352870
N-ethyl-1-(4-methoxyphenyl)-N-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]propan-2-amine (PubChem CID 18352870) has the molecular formula C21H36N2O3S and a molecular weight of 396.60 g/mol. Its IUPAC name is N-ethyl-1-(4-methoxyphenyl)-N-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]propan-2-amine.
| Compound Name | N-ethyl-1-(4-methoxyphenyl)-N-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 18352870 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-ethyl-1-(4-methoxyphenyl)-N-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]propan-2-amine |
| SMILES | CCN(CC1CCN(S(=O)(=O)C(C)C)CC1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H36N2O3S/c1-6-22(18(4)15-19-7-9-21(26-5)10-8-19)16-20-11-13-23(14-12-20)27(24,25)17(2)3/h7-10,17-18,20H,6,11-16H2,1-5H3 |
| InChIKey | BQNMPRLHGWUENJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |