C10H12N4 — CID 18356580
N'-(1H-indazol-6-ylmethyl)ethanimidamide (PubChem CID 18356580) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is N'-(1H-indazol-6-ylmethyl)ethanimidamide.
| Compound Name | N'-(1H-indazol-6-ylmethyl)ethanimidamide |
|---|---|
| PubChem CID | 18356580 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N'-(1H-indazol-6-ylmethyl)ethanimidamide |
| SMILES | C/C(N)=N\Cc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C10H12N4/c1-7(11)12-5-8-2-3-9-6-13-14-10(9)4-8/h2-4,6H,5H2,1H3,(H2,11,12)(H,13,14) |
| InChIKey | BVEHJZHNEZZBSA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|