C6H9N5O2 — CID 18358920
acetic acid;1,3,5-triazine-2-carboximidamide (PubChem CID 18358920) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is acetic acid;1,3,5-triazine-2-carboximidamide.
| Compound Name | acetic acid;1,3,5-triazine-2-carboximidamide |
|---|---|
| PubChem CID | 18358920 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | acetic acid;1,3,5-triazine-2-carboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ncncn1 |
| InChI | InChI=1S/C4H5N5.C2H4O2/c5-3(6)4-8-1-7-2-9-4;1-2(3)4/h1-2H,(H3,5,6);1H3,(H,3,4) |
| InChIKey | BSRUJQNIBNCEHK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|