About (E)-pent-3-en-1-ol;trioctylphosphane
(E)-pent-3-en-1-ol;trioctylphosphane (PubChem CID 18364001) has the molecular formula C29H61OP
and a molecular weight of 456.78 g/mol. Its IUPAC name is (E)-pent-3-en-1-ol;trioctylphosphane.
Molecular Properties
| Compound Name | (E)-pent-3-en-1-ol;trioctylphosphane |
| PubChem CID | 18364001 |
| Molecular Formula | C29H61OP |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.45 |
| IUPAC Name | (E)-pent-3-en-1-ol;trioctylphosphane |
| SMILES | C/C=C/CCO.CCCCCCCCP(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C24H51P.C5H10O/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3-4-5-6/h4-24H2,1-3H3;2-3,6H,4-5H2,1H3/b;3-2+ |
| InChIKey | OBHYMBHVSGHRMO-ZPYUXNTASA-N |
| XLogP | 10.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-pent-3-en-1-ol;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-pent-3-en-1-ol;trioctylphosphane?
The IUPAC name of (E)-pent-3-en-1-ol;trioctylphosphane (CID 18364001) is (E)-pent-3-en-1-ol;trioctylphosphane.
What is the SMILES notation for (E)-pent-3-en-1-ol;trioctylphosphane?
The canonical SMILES for (E)-pent-3-en-1-ol;trioctylphosphane is C/C=C/CCO.CCCCCCCCP(CCCCCCCC)CCCCCCCC.
What is the InChIKey of (E)-pent-3-en-1-ol;trioctylphosphane?
The InChIKey is OBHYMBHVSGHRMO-ZPYUXNTASA-N. The full InChI is InChI=1S/C24H51P.C5H10O/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3-4-5-6/h4-24H2,1-3H3;2-3,6H,4-5H2,1H3/b;3-2+.
What are the key properties of (E)-pent-3-en-1-ol;trioctylphosphane?
(E)-pent-3-en-1-ol;trioctylphosphane has a molecular weight of 456.78 g/mol, XLogP of 10.49, 23 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-pent-3-en-1-ol;trioctylphosphane is sourced from PubChem (CID 18364001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).