C33H32O3S — CID 18364261
methyl 5-phenyl-2-(2-tritylsulfanylacetyl)pentanoate (PubChem CID 18364261) has the molecular formula C33H32O3S and a molecular weight of 508.68 g/mol. Its IUPAC name is methyl 5-phenyl-2-(2-tritylsulfanylacetyl)pentanoate.
| Compound Name | methyl 5-phenyl-2-(2-tritylsulfanylacetyl)pentanoate |
|---|---|
| PubChem CID | 18364261 |
| Molecular Formula | C33H32O3S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | methyl 5-phenyl-2-(2-tritylsulfanylacetyl)pentanoate |
| SMILES | COC(=O)C(CCCc1ccccc1)C(=O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32O3S/c1-36-32(35)30(24-14-17-26-15-6-2-7-16-26)31(34)25-37-33(27-18-8-3-9-19-27,28-20-10-4-11-21-28)29-22-12-5-13-23-29/h2-13,15-16,18-23,30H,14,17,24-25H2,1H3 |
| InChIKey | AUBBQRYWDOJEBD-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|