C16H21ClN2O4 — CID 18368297
N-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]furan-3-carboxamide;hydrochloride (PubChem CID 18368297) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]furan-3-carboxamide;hydrochloride.
| Compound Name | N-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]furan-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18368297 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[4-[2-(2-methoxyethylamino)ethoxy]phenyl]furan-3-carboxamide;hydrochloride |
| SMILES | COCCNCCOc1ccc(NC(=O)c2ccoc2)cc1.Cl |
| InChI | InChI=1S/C16H20N2O4.ClH/c1-20-10-7-17-8-11-22-15-4-2-14(3-5-15)18-16(19)13-6-9-21-12-13;/h2-6,9,12,17H,7-8,10-11H2,1H3,(H,18,19);1H |
| InChIKey | NNNSKBQXOWWGNP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|