C18H24N2O3 — CID 18368378
N-[3,5-dimethyl-4-[2-(propan-2-ylamino)ethoxy]phenyl]furan-3-carboxamide (PubChem CID 18368378) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[3,5-dimethyl-4-[2-(propan-2-ylamino)ethoxy]phenyl]furan-3-carboxamide.
| Compound Name | N-[3,5-dimethyl-4-[2-(propan-2-ylamino)ethoxy]phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 18368378 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[3,5-dimethyl-4-[2-(propan-2-ylamino)ethoxy]phenyl]furan-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccoc2)cc(C)c1OCCNC(C)C |
| InChI | InChI=1S/C18H24N2O3/c1-12(2)19-6-8-23-17-13(3)9-16(10-14(17)4)20-18(21)15-5-7-22-11-15/h5,7,9-12,19H,6,8H2,1-4H3,(H,20,21) |
| InChIKey | WLWAXIJOWIXAMU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|