About [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate
[4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate (PubChem CID 18368742) has the molecular formula C20H18O5
and a molecular weight of 338.36 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate |
| PubChem CID | 18368742 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccccc1C(=O)Oc1ccc(OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C20H18O5/c1-4-13-23-18-8-6-5-7-17(18)20(22)25-16-11-9-15(10-12-16)24-19(21)14(2)3/h4-12H,1-2,13H2,3H3 |
| InChIKey | LLJBIWIQGVHKMH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate?
The IUPAC name of [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate (CID 18368742) is [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate.
What is the SMILES notation for [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate?
The canonical SMILES for [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate is C=CCOc1ccccc1C(=O)Oc1ccc(OC(=O)C(=C)C)cc1.
What is the InChIKey of [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate?
The InChIKey is LLJBIWIQGVHKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O5/c1-4-13-23-18-8-6-5-7-17(18)20(22)25-16-11-9-15(10-12-16)24-19(21)14(2)3/h4-12H,1-2,13H2,3H3.
What are the key properties of [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate?
[4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate has a molecular weight of 338.36 g/mol, XLogP of 3.95, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylprop-2-enoyloxy)phenyl] 2-prop-2-enoxybenzoate is sourced from PubChem (CID 18368742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).