C14H16N2O3 — CID 18371667
5-[5-amino-2-(2-hydroxyethylamino)phenyl]benzene-1,3-diol (PubChem CID 18371667) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-[5-amino-2-(2-hydroxyethylamino)phenyl]benzene-1,3-diol.
| Compound Name | 5-[5-amino-2-(2-hydroxyethylamino)phenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 18371667 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-[5-amino-2-(2-hydroxyethylamino)phenyl]benzene-1,3-diol |
| SMILES | Nc1ccc(NCCO)c(-c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C14H16N2O3/c15-10-1-2-14(16-3-4-17)13(7-10)9-5-11(18)8-12(19)6-9/h1-2,5-8,16-19H,3-4,15H2 |
| InChIKey | FSKFRCHUKHFHQM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|