C29H34N6O5S — CID 18372623
tert-butyl 2-[[5-[(8-hydroxyquinoline-7-carbonyl)amino]-1,3,4-thiadiazol-2-yl]amino]-6-(phenylmethoxyamino)hexanoate (PubChem CID 18372623) has the molecular formula C29H34N6O5S and a molecular weight of 578.70 g/mol. Its IUPAC name is tert-butyl 2-[[5-[(8-hydroxyquinoline-7-carbonyl)amino]-1,3,4-thiadiazol-2-yl]amino]-6-(phenylmethoxyamino)hexanoate.
| Compound Name | tert-butyl 2-[[5-[(8-hydroxyquinoline-7-carbonyl)amino]-1,3,4-thiadiazol-2-yl]amino]-6-(phenylmethoxyamino)hexanoate |
|---|---|
| PubChem CID | 18372623 |
| Molecular Formula | C29H34N6O5S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | tert-butyl 2-[[5-[(8-hydroxyquinoline-7-carbonyl)amino]-1,3,4-thiadiazol-2-yl]amino]-6-(phenylmethoxyamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCNOCc1ccccc1)Nc1nnc(NC(=O)c2ccc3cccnc3c2O)s1 |
| InChI | InChI=1S/C29H34N6O5S/c1-29(2,3)40-26(38)22(13-7-8-17-31-39-18-19-10-5-4-6-11-19)32-27-34-35-28(41-27)33-25(37)21-15-14-20-12-9-16-30-23(20)24(21)36/h4-6,9-12,14-16,22,31,36H,7-8,13,17-18H2,1-3H3,(H,32,34)(H,33,35,37) |
| InChIKey | OGPZFOXHNUKALH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|