(2-methylsulfanylphenoxy)boronic acid

C7H9BO3S — CID 18373948

IUPAC(2-methylsulfanylphenoxy)boronic acid
SMILESCSc1ccccc1OB(O)O
InChIInChI=1S/C7H9BO3S/c1-12-7-5-3-2-4-6(7)11-8(9)10/h2-5,9-10H,1H3
InChIKeyLPNQODUCRPKLPZ-UHFFFAOYSA-N
MW184.03 g/mol
LogP0.76
Rot. Bonds3

About (2-methylsulfanylphenoxy)boronic acid

(2-methylsulfanylphenoxy)boronic acid (PubChem CID 18373948) has the molecular formula C7H9BO3S and a molecular weight of 184.03 g/mol. Its IUPAC name is (2-methylsulfanylphenoxy)boronic acid.

Molecular Properties

Compound Name(2-methylsulfanylphenoxy)boronic acid
PubChem CID18373948
Molecular FormulaC7H9BO3S
Molecular Weight184.03 g/mol
Exact Mass184.04
IUPAC Name(2-methylsulfanylphenoxy)boronic acid
SMILESCSc1ccccc1OB(O)O
InChIInChI=1S/C7H9BO3S/c1-12-7-5-3-2-4-6(7)11-8(9)10/h2-5,9-10H,1H3
InChIKeyLPNQODUCRPKLPZ-UHFFFAOYSA-N
XLogP0.76
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.03
LogP ≤ 50.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-methylsulfanylphenoxy)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methylsulfanylphenoxy)boronic acid?
The IUPAC name of (2-methylsulfanylphenoxy)boronic acid (CID 18373948) is (2-methylsulfanylphenoxy)boronic acid.
What is the SMILES notation for (2-methylsulfanylphenoxy)boronic acid?
The canonical SMILES for (2-methylsulfanylphenoxy)boronic acid is CSc1ccccc1OB(O)O.
What is the InChIKey of (2-methylsulfanylphenoxy)boronic acid?
The InChIKey is LPNQODUCRPKLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BO3S/c1-12-7-5-3-2-4-6(7)11-8(9)10/h2-5,9-10H,1H3.
What are the key properties of (2-methylsulfanylphenoxy)boronic acid?
(2-methylsulfanylphenoxy)boronic acid has a molecular weight of 184.03 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfanylphenoxy)boronic acid is sourced from PubChem (CID 18373948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).