C12H19ClN4 — CID 18374674
N-piperidin-4-yl-N-prop-2-enylpyrimidin-2-amine;hydrochloride (PubChem CID 18374674) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is N-piperidin-4-yl-N-prop-2-enylpyrimidin-2-amine;hydrochloride.
| Compound Name | N-piperidin-4-yl-N-prop-2-enylpyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 18374674 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-piperidin-4-yl-N-prop-2-enylpyrimidin-2-amine;hydrochloride |
| SMILES | C=CCN(c1ncccn1)C1CCNCC1.Cl |
| InChI | InChI=1S/C12H18N4.ClH/c1-2-10-16(11-4-8-13-9-5-11)12-14-6-3-7-15-12;/h2-3,6-7,11,13H,1,4-5,8-10H2;1H |
| InChIKey | VTFDJNXMMFVHFO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|