C18H23N5 — CID 56701175
6-piperidin-4-yl-N-prop-2-enyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 56701175) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 6-piperidin-4-yl-N-prop-2-enyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-piperidin-4-yl-N-prop-2-enyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 56701175 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 6-piperidin-4-yl-N-prop-2-enyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | C=CCN(Cc1ccccn1)c1cc(C2CCNCC2)ncn1 |
| InChI | InChI=1S/C18H23N5/c1-2-11-23(13-16-5-3-4-8-20-16)18-12-17(21-14-22-18)15-6-9-19-10-7-15/h2-5,8,12,14-15,19H,1,6-7,9-11,13H2 |
| InChIKey | LJRNVAMDJFATQY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|