C15H16N4O — CID 18375160
2-anilino-8-ethyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375160) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-anilino-8-ethyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-8-ethyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18375160 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-anilino-8-ethyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCN1C(=O)CCc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C15H16N4O/c1-2-19-13(20)9-8-11-10-16-15(18-14(11)19)17-12-6-4-3-5-7-12/h3-7,10H,2,8-9H2,1H3,(H,16,17,18) |
| InChIKey | FVALCJVWJJMQGL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |