About 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one
2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 134131474) has the molecular formula C18H18N6O
and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 134131474 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cn1cc(N2C(=O)C(C)(C)c3cnc(Nc4ccccc4)nc32)cn1 |
| InChI | InChI=1S/C18H18N6O/c1-18(2)14-10-19-17(21-12-7-5-4-6-8-12)22-15(14)24(16(18)25)13-9-20-23(3)11-13/h4-11H,1-3H3,(H,19,21,22) |
| InChIKey | RLLWUKYZBGOFRP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one (CID 134131474) is 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one is Cn1cc(N2C(=O)C(C)(C)c3cnc(Nc4ccccc4)nc32)cn1.
What is the InChIKey of 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is RLLWUKYZBGOFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N6O/c1-18(2)14-10-19-17(21-12-7-5-4-6-8-12)22-15(14)24(16(18)25)13-9-20-23(3)11-13/h4-11H,1-3H3,(H,19,21,22).
What are the key properties of 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one?
2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 334.38 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-5,5-dimethyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 134131474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).