C25H26N4O — CID 123859757
2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;but-2-yne (PubChem CID 123859757) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;but-2-yne.
| Compound Name | 2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;but-2-yne |
|---|---|
| PubChem CID | 123859757 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;but-2-yne |
| SMILES | CC#CC.CN1C(=O)C(C)(C)c2cnc(Nc3ccccc3)nc2-c2ccccc21 |
| InChI | InChI=1S/C21H20N4O.C4H6/c1-21(2)16-13-22-20(23-14-9-5-4-6-10-14)24-18(16)15-11-7-8-12-17(15)25(3)19(21)26;1-3-4-2/h4-13H,1-3H3,(H,22,23,24);1-2H3 |
| InChIKey | GCGABVFIEFEFDV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|