C22H23IN4O — CID 123863864
2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;iodomethane (PubChem CID 123863864) has the molecular formula C22H23IN4O and a molecular weight of 486.36 g/mol. Its IUPAC name is 2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;iodomethane.
| Compound Name | 2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;iodomethane |
|---|---|
| PubChem CID | 123863864 |
| Molecular Formula | C22H23IN4O |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-anilino-5,5,7-trimethylpyrimido[5,4-d][1]benzazepin-6-one;iodomethane |
| SMILES | CI.CN1C(=O)C(C)(C)c2cnc(Nc3ccccc3)nc2-c2ccccc21 |
| InChI | InChI=1S/C21H20N4O.CH3I/c1-21(2)16-13-22-20(23-14-9-5-4-6-10-14)24-18(16)15-11-7-8-12-17(15)25(3)19(21)26;1-2/h4-13H,1-3H3,(H,22,23,24);1H3 |
| InChIKey | GNGBAKNJBFJVQQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|