C19H16N4O4S — CID 59851102
4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid (PubChem CID 59851102) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59851102 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid |
| SMILES | CN1C(=O)Cc2cnc(Nc3ccc(S(=O)(=O)O)cc3)nc2-c2ccccc21 |
| InChI | InChI=1S/C19H16N4O4S/c1-23-16-5-3-2-4-15(16)18-12(10-17(23)24)11-20-19(22-18)21-13-6-8-14(9-7-13)28(25,26)27/h2-9,11H,10H2,1H3,(H,20,21,22)(H,25,26,27) |
| InChIKey | KEXWVGVCXZNPAT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|