C28H26N6O2 — CID 59851947
N-[4-(dimethylamino)phenyl]-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide (PubChem CID 59851947) has the molecular formula C28H26N6O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 59851947 |
| Molecular Formula | C28H26N6O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-[(7-methyl-6-oxo-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(Nc3ncc4c(n3)-c3ccccc3N(C)C(=O)C4)cc2)cc1 |
| InChI | InChI=1S/C28H26N6O2/c1-33(2)22-14-12-20(13-15-22)30-27(36)18-8-10-21(11-9-18)31-28-29-17-19-16-25(35)34(3)24-7-5-4-6-23(24)26(19)32-28/h4-15,17H,16H2,1-3H3,(H,30,36)(H,29,31,32) |
| InChIKey | YRGPRCKOOLUJPN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|