C27H32N6O2 — CID 143213935
2-[4-[[(1-ethylpyrrolidin-3-yl)methylamino]-hydroxymethyl]anilino]-7-methyl-5H-pyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 143213935) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[4-[[(1-ethylpyrrolidin-3-yl)methylamino]-hydroxymethyl]anilino]-7-methyl-5H-pyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 2-[4-[[(1-ethylpyrrolidin-3-yl)methylamino]-hydroxymethyl]anilino]-7-methyl-5H-pyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 143213935 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[4-[[(1-ethylpyrrolidin-3-yl)methylamino]-hydroxymethyl]anilino]-7-methyl-5H-pyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | CCN1CCC(CNC(O)c2ccc(Nc3ncc4c(n3)-c3ccccc3N(C)C(=O)C4)cc2)C1 |
| InChI | InChI=1S/C27H32N6O2/c1-3-33-13-12-18(17-33)15-28-26(35)19-8-10-21(11-9-19)30-27-29-16-20-14-24(34)32(2)23-7-5-4-6-22(23)25(20)31-27/h4-11,16,18,26,28,35H,3,12-15,17H2,1-2H3,(H,29,30,31) |
| InChIKey | GWWKQQRJBHQXCC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|