C26H30N5O3+ — CID 143213987
[2-hydroxy-5-[[7-methyl-6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5H-pyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl]oxidanium (PubChem CID 143213987) has the molecular formula C26H30N5O3+ and a molecular weight of 460.56 g/mol. Its IUPAC name is [2-hydroxy-5-[[7-methyl-6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5H-pyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl]oxidanium.
| Compound Name | [2-hydroxy-5-[[7-methyl-6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5H-pyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl]oxidanium |
|---|---|
| PubChem CID | 143213987 |
| Molecular Formula | C26H30N5O3+ |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [2-hydroxy-5-[[7-methyl-6-oxo-10-(3-pyrrolidin-1-ylpropyl)-5H-pyrimido[5,4-d][1]benzazepin-2-yl]amino]phenyl]oxidanium |
| SMILES | CN1C(=O)Cc2cnc(Nc3ccc(O)c([OH2+])c3)nc2-c2cc(CCCN3CCCC3)ccc21 |
| InChI | InChI=1S/C26H29N5O3/c1-30-21-8-6-17(5-4-12-31-10-2-3-11-31)13-20(21)25-18(14-24(30)34)16-27-26(29-25)28-19-7-9-22(32)23(33)15-19/h6-9,13,15-16,32-33H,2-5,10-12,14H2,1H3,(H,27,28,29)/p+1 |
| InChIKey | JQSHBMBGJZAIGH-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 104.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|