C12H11N5O — CID 90878069
2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one (PubChem CID 90878069) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90878069 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one |
| SMILES | O=C1NCc2cnc(Nc3ccccc3)nc2N1 |
| InChI | InChI=1S/C12H11N5O/c18-12-14-7-8-6-13-11(16-10(8)17-12)15-9-4-2-1-3-5-9/h1-6H,7H2,(H3,13,14,15,16,17,18) |
| InChIKey | PSQMKUGZZLSFBL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |