About 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one
2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one (PubChem CID 90878069) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one |
| PubChem CID | 90878069 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one |
| SMILES | O=C1NCc2cnc(Nc3ccccc3)nc2N1 |
| InChI | InChI=1S/C12H11N5O/c18-12-14-7-8-6-13-11(16-10(8)17-12)15-9-4-2-1-3-5-9/h1-6H,7H2,(H3,13,14,15,16,17,18) |
| InChIKey | PSQMKUGZZLSFBL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
The IUPAC name of 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one (CID 90878069) is 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
The canonical SMILES for 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one is O=C1NCc2cnc(Nc3ccccc3)nc2N1.
What is the InChIKey of 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
The InChIKey is PSQMKUGZZLSFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O/c18-12-14-7-8-6-13-11(16-10(8)17-12)15-9-4-2-1-3-5-9/h1-6H,7H2,(H3,13,14,15,16,17,18).
What are the key properties of 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one has a molecular weight of 241.25 g/mol, XLogP of 1.86, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 90878069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).