C36H42N7O2+ — CID 18375557
tert-butyl 4-[[1-amino-1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-1-ium-5-yl]methyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 18375557) has the molecular formula C36H42N7O2+ and a molecular weight of 604.78 g/mol. Its IUPAC name is tert-butyl 4-[[1-amino-1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-1-ium-5-yl]methyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-amino-1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-1-ium-5-yl]methyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18375557 |
| Molecular Formula | C36H42N7O2+ |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | tert-butyl 4-[[1-amino-1-[2-(1-phenylethylamino)pyrimidin-4-yl]benzimidazol-1-ium-5-yl]methyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CC(Nc1nccc([N+]2(N)C=Nc3cc(CC4(c5ccccc5)CCN(C(=O)OC(C)(C)C)CC4)ccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C36H42N7O2/c1-26(28-11-7-5-8-12-28)40-33-38-20-17-32(41-33)43(37)25-39-30-23-27(15-16-31(30)43)24-36(29-13-9-6-10-14-29)18-21-42(22-19-36)34(44)45-35(2,3)4/h5-17,20,23,25-26H,18-19,21-22,24,37H2,1-4H3,(H,38,40,41)/q+1 |
| InChIKey | BXLICXHWVZXYJX-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|