C14H21NO6P- — CID 18378300
(3-methoxyphenyl) 2-(pentanoylamino)ethyl phosphate (PubChem CID 18378300) has the molecular formula C14H21NO6P- and a molecular weight of 330.30 g/mol. Its IUPAC name is (3-methoxyphenyl) 2-(pentanoylamino)ethyl phosphate.
| Compound Name | (3-methoxyphenyl) 2-(pentanoylamino)ethyl phosphate |
|---|---|
| PubChem CID | 18378300 |
| Molecular Formula | C14H21NO6P- |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3-methoxyphenyl) 2-(pentanoylamino)ethyl phosphate |
| SMILES | CCCCC(=O)NCCOP(=O)([O-])Oc1cccc(OC)c1 |
| InChI | InChI=1S/C14H22NO6P/c1-3-4-8-14(16)15-9-10-20-22(17,18)21-13-7-5-6-12(11-13)19-2/h5-7,11H,3-4,8-10H2,1-2H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | SEXKZGDCFUUCSD-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|