C18H28NO7P — CID 18378274
methyl 3-[hydroxy-[2-(octanoylamino)ethoxy]phosphoryl]oxybenzoate (PubChem CID 18378274) has the molecular formula C18H28NO7P and a molecular weight of 401.40 g/mol. Its IUPAC name is methyl 3-[hydroxy-[2-(octanoylamino)ethoxy]phosphoryl]oxybenzoate.
| Compound Name | methyl 3-[hydroxy-[2-(octanoylamino)ethoxy]phosphoryl]oxybenzoate |
|---|---|
| PubChem CID | 18378274 |
| Molecular Formula | C18H28NO7P |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | methyl 3-[hydroxy-[2-(octanoylamino)ethoxy]phosphoryl]oxybenzoate |
| SMILES | CCCCCCCC(=O)NCCOP(=O)(O)Oc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H28NO7P/c1-3-4-5-6-7-11-17(20)19-12-13-25-27(22,23)26-16-10-8-9-15(14-16)18(21)24-2/h8-10,14H,3-7,11-13H2,1-2H3,(H,19,20)(H,22,23) |
| InChIKey | QLRRSJFVALEYBT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|