C20H27NO5P- — CID 18378437
naphthalen-1-yl 2-(octanoylamino)ethyl phosphate (PubChem CID 18378437) has the molecular formula C20H27NO5P- and a molecular weight of 392.41 g/mol. Its IUPAC name is naphthalen-1-yl 2-(octanoylamino)ethyl phosphate.
| Compound Name | naphthalen-1-yl 2-(octanoylamino)ethyl phosphate |
|---|---|
| PubChem CID | 18378437 |
| Molecular Formula | C20H27NO5P- |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | naphthalen-1-yl 2-(octanoylamino)ethyl phosphate |
| SMILES | CCCCCCCC(=O)NCCOP(=O)([O-])Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H28NO5P/c1-2-3-4-5-6-14-20(22)21-15-16-25-27(23,24)26-19-13-9-11-17-10-7-8-12-18(17)19/h7-13H,2-6,14-16H2,1H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | OMMJQRDZSBUVTC-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|