C16H21ClN2O2S — CID 18378938
methyl 7-(4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)heptanoate (PubChem CID 18378938) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is methyl 7-(4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)heptanoate.
| Compound Name | methyl 7-(4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)heptanoate |
|---|---|
| PubChem CID | 18378938 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | methyl 7-(4-chloro-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)heptanoate |
| SMILES | COC(=O)CCCCCCc1nc(Cl)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C16H21ClN2O2S/c1-10-11(2)22-16-14(10)15(17)18-12(19-16)8-6-4-5-7-9-13(20)21-3/h4-9H2,1-3H3 |
| InChIKey | CXGOXWWHIFQDJI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|