C26H24F5N7O3 — CID 18385176
5-[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]pentanimidamide;2,2,2-trifluoroacetic acid (PubChem CID 18385176) has the molecular formula C26H24F5N7O3 and a molecular weight of 577.51 g/mol. Its IUPAC name is 5-[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]pentanimidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]pentanimidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18385176 |
| Molecular Formula | C26H24F5N7O3 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | 5-[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]pentanimidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)CCCCn1cc(-n2c(-c3cn(C)c4ccc(F)cc34)n[nH]c2=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C24H23F2N7O.C2HF3O2/c1-31-12-18(16-10-14(25)5-7-19(16)31)23-29-30-24(34)33(23)21-13-32(9-3-2-4-22(27)28)20-8-6-15(26)11-17(20)21;3-2(4,5)1(6)7/h5-8,10-13H,2-4,9H2,1H3,(H3,27,28)(H,30,34);(H,6,7) |
| InChIKey | AQYPWWRTQUNIIJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|