C29H25F2N7O — CID 18337794
3-[[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]methyl]-N,N-dimethylbenzenecarboximidamide (PubChem CID 18337794) has the molecular formula C29H25F2N7O and a molecular weight of 525.56 g/mol. Its IUPAC name is 3-[[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]methyl]-N,N-dimethylbenzenecarboximidamide.
| Compound Name | 3-[[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]methyl]-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 18337794 |
| Molecular Formula | C29H25F2N7O |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 3-[[5-fluoro-3-[3-(5-fluoro-1-methylindol-3-yl)-5-oxo-1H-1,2,4-triazol-4-yl]indol-1-yl]methyl]-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1cccc(Cn2cc(-n3c(-c4cn(C)c5ccc(F)cc45)n[nH]c3=O)c3cc(F)ccc32)c1)N(C)C |
| InChI | InChI=1S/C29H25F2N7O/c1-35(2)27(32)18-6-4-5-17(11-18)14-37-16-26(22-13-20(31)8-10-25(22)37)38-28(33-34-29(38)39)23-15-36(3)24-9-7-19(30)12-21(23)24/h4-13,15-16,32H,14H2,1-3H3,(H,34,39)/b32-27- |
| InChIKey | JBZDDPWFYDUZKC-MXNGAVTRSA-N |
| XLogP | 4.89 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|