C31H27F2N7O2 — CID 18385049
3-(5-fluoro-1-methylindol-3-yl)-4-[5-fluoro-1-[[3-(morpholine-4-carboximidoyl)phenyl]methyl]indol-3-yl]-1H-1,2,4-triazol-5-one (PubChem CID 18385049) has the molecular formula C31H27F2N7O2 and a molecular weight of 567.60 g/mol. Its IUPAC name is 3-(5-fluoro-1-methylindol-3-yl)-4-[5-fluoro-1-[[3-(morpholine-4-carboximidoyl)phenyl]methyl]indol-3-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(5-fluoro-1-methylindol-3-yl)-4-[5-fluoro-1-[[3-(morpholine-4-carboximidoyl)phenyl]methyl]indol-3-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 18385049 |
| Molecular Formula | C31H27F2N7O2 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 3-(5-fluoro-1-methylindol-3-yl)-4-[5-fluoro-1-[[3-(morpholine-4-carboximidoyl)phenyl]methyl]indol-3-yl]-1H-1,2,4-triazol-5-one |
| SMILES | [H]/N=C(/c1cccc(Cn2cc(-n3c(-c4cn(C)c5ccc(F)cc45)n[nH]c3=O)c3cc(F)ccc32)c1)N1CCOCC1 |
| InChI | InChI=1S/C31H27F2N7O2/c1-37-17-25(23-14-21(32)5-7-26(23)37)30-35-36-31(41)40(30)28-18-39(27-8-6-22(33)15-24(27)28)16-19-3-2-4-20(13-19)29(34)38-9-11-42-12-10-38/h2-8,13-15,17-18,34H,9-12,16H2,1H3,(H,36,41)/b34-29- |
| InChIKey | OAHKHFOEBQKJMD-BNIPGBBVSA-N |
| XLogP | 4.66 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|