C23H19FN8O — CID 18385286
4-[2-(azidomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one (PubChem CID 18385286) has the molecular formula C23H19FN8O and a molecular weight of 442.46 g/mol. Its IUPAC name is 4-[2-(azidomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[2-(azidomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 18385286 |
| Molecular Formula | C23H19FN8O |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[2-(azidomethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]-3-(5-fluoro-1-methylindol-3-yl)-1H-1,2,4-triazol-5-one |
| SMILES | Cn1cc(-c2n[nH]c(=O)n2-c2c3n(c4ccccc24)CC(CN=[N+]=[N-])C3)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H19FN8O/c1-30-12-17(16-9-14(24)6-7-18(16)30)22-27-28-23(33)32(22)21-15-4-2-3-5-19(15)31-11-13(8-20(21)31)10-26-29-25/h2-7,9,12-13H,8,10-11H2,1H3,(H,28,33) |
| InChIKey | YQTBIHCWWOKJAB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|