C17H23NO2S2 — CID 18386582
4-(2,2-dimethylpropanoyl)-2-methyl-N-phenyl-1,3-dithiane-4-carboxamide (PubChem CID 18386582) has the molecular formula C17H23NO2S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-2-methyl-N-phenyl-1,3-dithiane-4-carboxamide.
| Compound Name | 4-(2,2-dimethylpropanoyl)-2-methyl-N-phenyl-1,3-dithiane-4-carboxamide |
|---|---|
| PubChem CID | 18386582 |
| Molecular Formula | C17H23NO2S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-2-methyl-N-phenyl-1,3-dithiane-4-carboxamide |
| SMILES | CC1SCCC(C(=O)Nc2ccccc2)(C(=O)C(C)(C)C)S1 |
| InChI | InChI=1S/C17H23NO2S2/c1-12-21-11-10-17(22-12,14(19)16(2,3)4)15(20)18-13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3,(H,18,20) |
| InChIKey | KOWYNTICXAUFGF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|