C16H34N2O3+2 — CID 18389915
bis(2-hydroxyethyl)-[(1R,2S,3R,4R)-3-(2-hydroxyethylazaniumyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]azanium (PubChem CID 18389915) has the molecular formula C16H34N2O3+2 and a molecular weight of 302.46 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-[(1R,2S,3R,4R)-3-(2-hydroxyethylazaniumyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]azanium.
| Compound Name | bis(2-hydroxyethyl)-[(1R,2S,3R,4R)-3-(2-hydroxyethylazaniumyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]azanium |
|---|---|
| PubChem CID | 18389915 |
| Molecular Formula | C16H34N2O3+2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | bis(2-hydroxyethyl)-[(1R,2S,3R,4R)-3-(2-hydroxyethylazaniumyl)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]azanium |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H]([NH+](CCO)CCO)[C@@H]2[NH2+]CCO |
| InChI | InChI=1S/C16H32N2O3/c1-15(2)12-4-5-16(15,3)14(13(12)17-6-9-19)18(7-10-20)8-11-21/h12-14,17,19-21H,4-11H2,1-3H3/p+2/t12-,13+,14+,16-/m0/s1 |
| InChIKey | ZYCSCYZDDHQTMB-NHIYQJMISA-P |
| XLogP | -2.40 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |