C21H21NO6 — CID 18391204
methyl (E)-3-methoxy-2-[2-[(E)-(2-phenylmethoxyacetyl)oxyiminomethyl]phenyl]prop-2-enoate (PubChem CID 18391204) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is methyl (E)-3-methoxy-2-[2-[(E)-(2-phenylmethoxyacetyl)oxyiminomethyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-methoxy-2-[2-[(E)-(2-phenylmethoxyacetyl)oxyiminomethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 18391204 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | methyl (E)-3-methoxy-2-[2-[(E)-(2-phenylmethoxyacetyl)oxyiminomethyl]phenyl]prop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1/C=N/OC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C21H21NO6/c1-25-14-19(21(24)26-2)18-11-7-6-10-17(18)12-22-28-20(23)15-27-13-16-8-4-3-5-9-16/h3-12,14H,13,15H2,1-2H3/b19-14+,22-12+ |
| InChIKey | CDPJETYMIWHURN-WMDKKPGZSA-N |
| XLogP | 2.94 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|