C11H19BN2O3 — CID 18391461
[1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid (PubChem CID 18391461) has the molecular formula C11H19BN2O3 and a molecular weight of 238.10 g/mol. Its IUPAC name is [1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 18391461 |
| Molecular Formula | C11H19BN2O3 |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | [1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]pyrrolidin-2-yl]boronic acid |
| SMILES | N[C@@H]1CC=CC[C@H]1C(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C11H19BN2O3/c13-9-5-2-1-4-8(9)11(15)14-7-3-6-10(14)12(16)17/h1-2,8-10,16-17H,3-7,13H2/t8-,9-,10?/m1/s1 |
| InChIKey | SMODZDWDAYGSIG-MGRQHWMJSA-N |
| XLogP | -0.72 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|