C13H20N3O+ — CID 56975377
(2R)-1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]-2-methylpyrrolidin-1-ium-1-carbonitrile (PubChem CID 56975377) has the molecular formula C13H20N3O+ and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R)-1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]-2-methylpyrrolidin-1-ium-1-carbonitrile.
| Compound Name | (2R)-1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]-2-methylpyrrolidin-1-ium-1-carbonitrile |
|---|---|
| PubChem CID | 56975377 |
| Molecular Formula | C13H20N3O+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R)-1-[(1R,6R)-6-aminocyclohex-3-ene-1-carbonyl]-2-methylpyrrolidin-1-ium-1-carbonitrile |
| SMILES | C[C@@H]1CCC[N+]1(C#N)C(=O)[C@@H]1CC=CC[C@H]1N |
| InChI | InChI=1S/C13H20N3O/c1-10-5-4-8-16(10,9-14)13(17)11-6-2-3-7-12(11)15/h2-3,10-12H,4-8,15H2,1H3/q+1/t10-,11-,12-,16?/m1/s1 |
| InChIKey | HZJBZPITBWRZQF-PCWNFTPZSA-N |
| XLogP | 1.29 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|