C35H68O4Si2 — CID 18395455
7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoic acid (PubChem CID 18395455) has the molecular formula C35H68O4Si2 and a molecular weight of 609.10 g/mol. Its IUPAC name is 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 18395455 |
| Molecular Formula | C35H68O4Si2 |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.47 |
| IUPAC Name | 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoic acid |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(CCCCCCC(=O)O)=C(C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H68O4Si2/c1-14-15-20-27(2)25-29(38-40(10,11)34(4,5)6)23-24-31-30(21-18-16-17-19-22-33(36)37)28(3)26-32(31)39-41(12,13)35(7,8)9/h23-24,27,29,31-32H,14-22,25-26H2,1-13H3,(H,36,37)/b24-23+/t27-,29-,31-,32-/m1/s1 |
| InChIKey | YGKKTTUPVCAVNA-RKSAIOQKSA-N |
| XLogP | 11.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|