C24H37N3O6S — CID 18397257
N-[(2S)-4-cyclopentyl-2-[[(4-methoxyphenyl)sulfonyl-methylamino]methyl]butanoyl]-N-hydroxypiperidine-1-carboxamide (PubChem CID 18397257) has the molecular formula C24H37N3O6S and a molecular weight of 495.64 g/mol. Its IUPAC name is N-[(2S)-4-cyclopentyl-2-[[(4-methoxyphenyl)sulfonyl-methylamino]methyl]butanoyl]-N-hydroxypiperidine-1-carboxamide.
| Compound Name | N-[(2S)-4-cyclopentyl-2-[[(4-methoxyphenyl)sulfonyl-methylamino]methyl]butanoyl]-N-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 18397257 |
| Molecular Formula | C24H37N3O6S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-[(2S)-4-cyclopentyl-2-[[(4-methoxyphenyl)sulfonyl-methylamino]methyl]butanoyl]-N-hydroxypiperidine-1-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C[C@H](CCC2CCCC2)C(=O)N(O)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H37N3O6S/c1-25(34(31,32)22-14-12-21(33-2)13-15-22)18-20(11-10-19-8-4-5-9-19)23(28)27(30)24(29)26-16-6-3-7-17-26/h12-15,19-20,30H,3-11,16-18H2,1-2H3/t20-/m0/s1 |
| InChIKey | RUFPELZIVMXKHZ-FQEVSTJZSA-N |
| XLogP | 3.73 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|