C23H37N3O6S — CID 54365569
(2S,3R)-N-hydroxy-2-[2-[(4-methoxyphenyl)sulfonyl-methylamino]ethyl]-5-methyl-3-(piperidine-1-carbonyl)hexanamide (PubChem CID 54365569) has the molecular formula C23H37N3O6S and a molecular weight of 483.63 g/mol. Its IUPAC name is (2S,3R)-N-hydroxy-2-[2-[(4-methoxyphenyl)sulfonyl-methylamino]ethyl]-5-methyl-3-(piperidine-1-carbonyl)hexanamide.
| Compound Name | (2S,3R)-N-hydroxy-2-[2-[(4-methoxyphenyl)sulfonyl-methylamino]ethyl]-5-methyl-3-(piperidine-1-carbonyl)hexanamide |
|---|---|
| PubChem CID | 54365569 |
| Molecular Formula | C23H37N3O6S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (2S,3R)-N-hydroxy-2-[2-[(4-methoxyphenyl)sulfonyl-methylamino]ethyl]-5-methyl-3-(piperidine-1-carbonyl)hexanamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H37N3O6S/c1-17(2)16-21(23(28)26-13-6-5-7-14-26)20(22(27)24-29)12-15-25(3)33(30,31)19-10-8-18(32-4)9-11-19/h8-11,17,20-21,29H,5-7,12-16H2,1-4H3,(H,24,27)/t20-,21+/m0/s1 |
| InChIKey | UPNJLHKRSPLWHE-LEWJYISDSA-N |
| XLogP | 2.50 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|